Omega 3 fatty acids and derivatives

Product #

Description

Molecular Formula

Add to Cart

H7898 15(S)-Hydroxy-(5Z,8Z,11Z,13E,17Z)-eicosapentaenoic acid ~100 μg/mL in ethanol, ~98% C20H30O3 318.5
L2376 Linolenic acid ≥99% CH3(CH2CH=CH)3(CH2)7CO2H 278.4
17266 Methyl all-cis-5,8,11,14,17-eicosapentaenoate analytical standard CH3(CH2CH=CH)5(CH2)3CO2CH3 316.5
62200 Methyl linolenate analytical standard CH3(CH2CH=CH)3(CH2)7COOCH3 292.5
62210 Methyl linolenate technical, 70-80% (GC) CH3(CH2CH=CH)3(CH2)7COOCH3 292.5
SMB00291 Stearidonic acid ≥99% C18H28O2 276.4
D1797 all-cis-7,10,13,16,19-Docosapentaenoic acid synthetic, ≥97% C22H34O2 330.5
D2410 cis-4,7,10,13,16,19-Docosahexaenoic acid ethyl ester ≥97% C24H36O2 356.5
D2659 cis-4,7,10,13,16,19-Docosahexaenoic acid methyl ester ≥98% CH3(CH2CH=CH)6CH2CH2CO2CH3 342.5
D2534 cis-4,7,10,13,16,19-Docosahexaenoic acid ≥98% C22H32O2 328.5
E6627 cis-5,8,11,14,17-Eicosapentaenoic acid sodium salt ≥99% (capillary GC) CH3(CH2CH=CH)5(CH2)3CO2Na 324.4
E7006 cis-5,8,11,14,17-Eicosapentaenoic acid ≥85%, liquid CH3(CH2CH=CH)5(CH2)3CO2H 302.5
E2011 cis-5,8,11,14,17-Eicosapentaenoic acid ≥99% CH3(CH2CH=CH)5(CH2)3CO2H 302.5
44864 cis-5,8,11,14,17-Eicosapentaenoic acid analytical standard CH3(CH2CH=CH)5(CH2)3CO2H 302.5
62174 γ-Linolenic acid analytical standard C18H30O2 278.4
L3763 γ-Linolenyl alcohol ≥99%, liquid C18H32O 264.5