Fatty Acids

Product #

Description

Molecular Formula

Add to Cart

46944-U (−) Quinic acid analytical standard C7H12O6 192.2
46940-U D-Malic acid analytical standard HO2CCH2CH(OH)CO2H 134.1
46937 L-(+)-Lactic acid analytical standard C3H6O3 90.1
11909 Behenic acid analytical standard CH3(CH2)20COOH 340.6
46933 Citric acid analytical standard HOC(COOH)(CH2COOH)2 192.1
21409 Decanoic acid analytical standard CH3(CH2)8COOH 172.3
61609 Dodecanoic acid analytical standard CH3(CH2)10COOH 200.3
45089 Elaidic acid analytical standard CH3(CH2)7CH=CH(CH2)7COOH 282.5
21529 Hexanoic acid analytical standard CH3(CH2)4COOH 116.2
46935-U Isobutyric acid analytical standard (CH3)2CHCO2H 88.1
62230 Linoleic acid analytical standard CH3(CH2)4CH=CHCH2CH=CH(CH2)7CO2H 280.5
62160 Linolenic acid analytical standard CH3(CH2CH=CH)3(CH2)7CO2H 278.4
46938-U Malonic acid analytical standard CH2(COOH)2 104.1
45997 Methyl acetate analytical standard CH3COOCH3 74.1
76778 Methyl acrylate analytical standard CH2=CHCOOCH3 86.1
17266 Methyl all-cis-5,8,11,14,17-eicosapentaenoate analytical standard CH3(CH2CH=CH)5(CH2)3CO2CH3 316.5
17269 Methyl all-cis-7,10,13,16,19-docosapentaenoate analytical standard C23H36O2 344.5
10941 Methyl arachidate analytical standard CH3(CH2)18COOCH3 326.6
11940 Methyl behenate analytical standard CH3(CH2)20COOCH3 354.6
18344 Methyl benzoate analytical standard C6H5COOCH3 136.2
19358 Methyl butyrate analytical standard CH3CH2CH2COOCH3 102.1
17272 Methyl cis,cis-11,14-eicosadienoate analytical standard C21H38O2 322.5
42986 Methyl cis,cis-11,12;14,15-diepoxyeicosanoate qualitative standard, ≥97.0% (sum of stereoisomers, GC) C21H38O4 354.5
17263 Methyl cis-11-eicosenoate analytical standard CH3(CH2)7HC=CH(CH2)9CO2CH3 324.5
17264 Methyl cis-11-octadecenoate analytical standard C19H36O2 296.5
45659 Methyl cis-13-docosenoate analytical standard CH3(CH2)7CH=CH(CH2)11COOCH3 352.6
17265 Methyl cis-15-tetracosenoate analytical standard C25H48O2 380.7
47572-U Methyl cis-5,8,11,14-eicosatetraenoate solution certified reference material, 10 mg/mL in heptane    
21479 Methyl decanoate analytical standard CH3(CH2)8COOCH3 186.3
61689 Methyl dodecanoate analytical standard CH3(CH2)10COOCH3 214.3
45119 Methyl elaidate analytical standard CH3(CH2)7CH=CH(CH2)7COOCH3 296.5
06547 Methyl formate analytical standard HCO2CH3 60.1
00238 Methyl γ-linolenate solution analytical standard C19H32O2 292.5
51535 Methyl heneicosanoate analytical standard CH3(CH2)19COOCH3 340.6
51633 Methyl heptadecanoate analytical standard CH3(CH2)15COOCH3 284.5
75218 Methyl heptanoate analytical standard C8H16O2 144.2
52203 Methyl hexacosanoate analytical standard CH3(CH2)24COOCH3 410.7
21599 Methyl hexanoate analytical standard CH3(CH2)4COOCH3 130.2
36492 Methyl isovalerate analytical standard (CH3)2CHCH2COOCH3 116.2
62280 Methyl linoleate analytical standard CH3(CH2)3(CH2CH=CH)2(CH2)7CO2CH3 294.5
62155 Methyl linolelaidate analytical standard C19H34O2 294.5
62200 Methyl linolenate analytical standard CH3(CH2CH=CH)3(CH2)7COOCH3 292.5
70129 Methyl myristate analytical standard CH3(CH2)12COOCH3 242.4
70055 Methyl myristelaidate analytical standard C15H28O2 240.4
70121 Methyl myristoleate analytical standard C15H28O2 240.4
74208 Methyl nonadecanoate analytical standard CH3(CH2)17COOCH3 312.5
76368 Methyl nonanoate analytical standard CH3(CH2)7COOCH3 172.3
74701 Methyl octacosanoate analytical standard CH3(CH2)26COOCH3 438.8
21719 Methyl octanoate analytical standard CH3(CH2)6COOCH3 158.2
75160 Methyl oleate analytical standard CH3(CH2)7CH=CH(CH2)7CO2CH3 296.5
76159 Methyl palmitate analytical standard CH3(CH2)14CO2CH3 270.5
76176 Methyl palmitoleate analytical standard CH3(CH2)5CH=CH(CH2)7COOCH3 268.4
76497 Methyl pentacosanoate analytical standard CH3(CH2)23COOCH3 396.7
76560 Methyl pentadecanoate analytical standard CH3(CH2)13CO2CH3 256.4
81988 Methyl propionate analytical standard CH3CH2COOCH3 88.1
83916 Methyl ricinoleate analytical standard C19H36O3 312.5
85769 Methyl stearate analytical standard CH3(CH2)16CO2CH3 298.5
87115 Methyl tetracosanoate analytical standard CH3(CH2)22COOCH3 382.7
91478 Methyl tricosanoate analytical standard CH3(CH2)21COOCH3 368.6
91558 Methyl tridecanoate analytical standard CH3(CH2)11COOCH3 228.4
94118 Methyl undecanoate analytical standard CH3(CH2)9CO2CH3 200.3
94560 Methyl valerate analytical standard CH3(CH2)3CO2CH3 116.2
87117 Nervonic acid analytical standard CH3(CH2)7CH=CH(CH2)13COOH (cis) 366.6
72332 Nonadecanoic acid analytical standard CH3(CH2)17COOH 298.5
21639 Octanoic acid analytical standard CH3(CH2)6COOH 144.2
75090 Oleic acid analytical standard CH3(CH2)7CH=CH(CH2)7COOH 282.5
76119 Palmitic acid analytical standard CH3(CH2)14COOH 256.4
76169 Palmitoleic acid analytical standard CH3(CH2)5CH=CH(CH2)7COOH 254.4
91446 Pentadecanoic acid analytical standard CH3(CH2)13COOH 242.4
85679 Stearic acid analytical standard CH3(CH2)16COOH 284.5
46408 Stearyl stearate analytical standard CH3(CH2)16COO(CH2)17CH3 537
91988 Tridecanoic acid analytical standard CH3(CH2)11CO2H 214.3
89764 Undecanoic acid analytical standard CH3(CH2)9COOH 186.3
CRM47570 all-cis-4, 7, 10, 13, 16, 19-Docosahexaenoic acid methyl ester certified reference material, 10 mg/mL in heptane, ampule of 1 mL    
44878 cis-11-Eicosenoic acid analytical standard CH3(CH2)7CH=CH(CH2)9CO2H 310.5
CRM46904 cis-11-Vaccenic acid methyl ester certified reference material, 10 mg/mL in heptane, ampule of 1 mL CH3(CH2)5CH=CH(CH2)9CO2CH3 296.5
47198 cis-6-Octadecenoic acid methyl ester certified reference material, 10 mg/mL in heptane    
46950-U cis-9,cis-12-Octadecadienoic acid methyl ester certified reference material, 10 mg/mL in heptane    
46902-U cis-9-Octadecenoic acid methyl ester certified reference material, 10 mg/mL in heptane    
CRM47571 cis-5,8,11,14,17-Eicosapentaenoic acid methyl ester certified reference material, 10 mg/mL in heptane, ampule of 1 mL CH3(CH2CH=CH)5(CH2)3CO2CH3 316.5
44864 cis-5,8,11,14,17-Eicosapentaenoic acid analytical standard CH3(CH2CH=CH)5(CH2)3CO2H 302.5
CRM47563 cis-7,10,13,16,19-Docosapentenoic acid methyl ester certified reference material, 10 mg/mL in heptane, ampule of 1 mL    
00813 cis-8,11,14-Eicosatrienoic acid methyl ester solution ~0.1 g/mL in ethanol, analytical standard    
62174 γ-Linolenic acid analytical standard C18H30O2 278.4
10823 trans-11-Eicosenoic acid analytical standard C20H38O2 310.5
CRM47199 trans-6-Octadecenoic acid methyl ester certified reference material, 10 mg/mL in heptane, ampule of 1 mL    
46951-U trans-9,12-Octadecadienoic acid methyl ester certified reference material, 10 mg/mL in heptane    
CRM46903 trans-9-Octadecenoic acid methyl ester certified reference material, 10 mg/mL in heptane, ampule of 1 mL CH3(CH2)7CH=CH(CH2)7COOCH3 296.5