| P6641 | 1,2-Diacyl-sn-glycero-3-phospho-L-serine solution ~98%, from bovine brain, chloroform:methanol solution | | | pricing |
|
| P6354 | 1,2-Dioleoyl-sn-glycero-3-phosphocholine lyophilized powder | C44H84NO8P | 786.1 | pricing |
|
| D0138 | 1,2-Dioleoyl-sn-glycerol ~98% | C39H72O5 | 621 | pricing |
|
| D3627 | 1,3-Diolein ≥99% (GC) | C39H72O5 | 621 | pricing |
|
| M7765 | 1-Oleoyl-rac-glycerol ~99% | CH3(CH2)7CH=CH(CH2)7COOCH2CHOHCH2OH | 356.5 | pricing |
|
| M2787 | 2-Oleoylglycerol ≥95% (TLC) | C21H40O4 | 356.5 | pricing |
|
| D1415 | 4,6-Dioxoheptanoic acid powder | CH3COCH2COCH2CH2CO2H | 158.2 | pricing |
|
| L4129 | L-α-Lysophosphatidylcholine from egg yolk ≥99%, Type I, powder | | | pricing |
|
| P0474 | L-α-Phosphatidyl-L-serine from Glycine max (soybean) ~98% | | | pricing |
|
| 61755 | L-α-Phosphatidylcholine BioChemika, from egg yolk, ~60% (TLC) | | | pricing |
|
| P5394 | L-α-Phosphatidylcholine from dried egg yolk, Type X-E, ≥40% (enzymatic) | | | pricing |
|
| P7443 | L-α-Phosphatidylcholine from soybean, ≥99% (TLC), lyophilized powder | | | pricing |
|
| P9763 | L-α-Phosphatidylinositol 4,5-diphosphate sodium salt from bovine brain ≥98% (TLC) | | | pricing |
|
| A0580 | Arachidonylethanolamide ~98% (TLC), oil | C22H37NO2 | 347.5 | pricing |
|
| C0563 | Cardiolipin sodium salt from bovine heart ≥98% (TLC), lyophilized powder | | | pricing |
|
| C1649 | Cardiolipin solution from bovine heart 4.7-5.3 mg/mL in ethanol, ≥97% (TLC) | | | pricing |
|
| 259853 | Castor oil | | | pricing |
|
| C9606 | Castor oil meets USP testing specifications | | | pricing |
|
| 18722 | Castor oil meets analytical specification of DAB, refined | | | pricing |
|
| 14606 | Cholesterol Ph Eur | C27H46O | 386.7 | pricing |
|
| 20808 | Cholesterol meets analytical specification of NF | C27H46O | 386.7 | pricing |
|
| C8267 | Corn oil | | | pricing |
|
| 74380 | Fish liver oil from Gadus morrhua Ph Eur | | | pricing |
|
| T2151 | Glyceryl triheptadecanoate ~99% | [CH3(CH2)15COOCH2]2CHOCO(CH2)15CH3 | 849.4 | pricing |
|
| G8284 | Glycolic acid SigmaUltra, ≥98% (titration) | HOCH2COOH | 76.1 | pricing |
|
| 60609 | Kaolin Ph Eur | ~Al2Si2O5(OH)4 | | pricing |
|
| K1512 | Kaolin meets USP testing specifications | ~Al2Si2O5(OH)4 | | pricing |
|
| 18616 | Kaolin meets analytical specification of Ph. Eur., BP, powder | ~Al2Si2O5(OH)4 | | pricing |
|
| 49909 | Lanolin Ph Eur | | | pricing |
|
| L6895 | Lipid A, monophosphoryl from Salmonella enterica serotype minnesota Re 595 (Re mutant) lyophilized powder | | | pricing |
|
| E2012 | Methyl all-cis-5,8,11,14,17-eicosapentaenoate ≥97% (capillary GC) | CH3(CH2CH=CH)5(CH2)3CO2CH3 | 316.5 | pricing |
|
| H4515 | Methyl heptadecanoate ≥99% | CH3(CH2)15COOCH3 | 284.5 | pricing |
|
| L2626 | Methyl linolenate ≥99% (GC) | CH3(CH2CH=CH)3(CH2)7COOCH3 | 292.5 | pricing |
|
| T9900 | Methyl tricosanoate ≥99.0% (GC) | CH3(CH2)21COOCH3 | 368.6 | pricing |
|
| P0503 | O-Phosphorylethanolamine | NH2CH2CH2OPO3H2 | 141.1 | pricing |
|
| C2875 | Octanoic acid ≥99% | CH3(CH2)6COOH | 144.2 | pricing |
|
| 75096 | Oleic acid Ph Eur | CH3(CH2)7CH=CH(CH2)7COOH | 282.5 | pricing |
|
| O1008 | Oleic acid reagent grade, ≥99% (GC) | CH3(CH2)7CH=CH(CH2)7COOH | 282.5 | pricing |
|
| 364525 | Oleic acid technical grade, 90% | CH3(CH2)7CH=CH(CH2)7COOH | 282.5 | pricing |
|
| 75343 | Olive oil Ph Eur | | | pricing |
|
| P9417 | Palmitoleic acid ≥99% (capillary GC), liquid | CH3(CH2)5CH=CH(CH2)7COOH | 254.4 | pricing |
|
| 18512 | Paraffin oil puriss., meets analytical specification of Ph. Eur., BP, viscous liquid | | | pricing |
|
| 76234 | Paraffin wax Ph Eur, high viscosity | | | pricing |
|
| 76233 | Paraffin wax Ph Eur, low viscosity | | | pricing |
|
| 76244 | Paraffin wax Ph Eur, pellets, white | | | pricing |
|
| 18634 | Paraffin wax meets analytical specification of Ph. Eur., white, pastilles | | | pricing |
|
| 18635 | Paraffin wax pastilles, white | | | pricing |
|
| 76228 | Paraffin wax purum, chunks (large), white | | | pricing |
|
| 95369 | Paraffin wax purum, extra-low viscosity | | | pricing |
|
| 76243 | Paraffin wax purum, pellets, white | | | pricing |
|
| 76232 | Paraffin wax purum, pellets, white | | | pricing |
|
| 93967 | Peanut oil hardened Ph Eur | | | pricing |
|
| P2191 | Poly(DL-lactide-co-glycolide) lactide:glycolide (50:50), mol wt 40,000-75,000 | [C3H4O2]x[C2H2O2]y | | pricing |
|
| 85067 | Sesame oil from Sesamum indicum Ph Eur | | | pricing |
|
| 78471 | Shellac wax-free Ph Eur | | | pricing |
|
| O7501 | Sodium oleate ≥99% | CH3(CH2)7CH=CH(CH2)7COONa | 304.4 | pricing |
|
| S4751 | Stearic acid Grade I, ≥98.5% (capillary GC) | CH3(CH2)16COOH | 284.5 | pricing |
|
| T0502 | Tridecanoic acid ≥98% | CH3(CH2)11CO2H | 214.3 | pricing |
|
| 16415 | Vaseline® meets analytical specification of Ph. Eur. | | | pricing |
|
| D2659 | cis-4,7,10,13,16,19-Docosahexaenoic acid methyl ester ≥98% | CH3(CH2CH=CH)6CH2CH2CO2CH3 | 342.5 | pricing |
|
Product # 
