
Product #



Molecular Formula

Add to Cart

CDS001319 5-Bromo-2-fluoropyridine-3-boronic acid AldrichCPR C5H4BBrFNO2
CDS009014 6-chloro-2-fluoropyridine-3-boronic acid AldrichCPR C5H4BClFNO2
CDS010298 2,6-difluoropyridine-4-boronic acid AldrichCPR C5H4BF2NO2
CDS003936 2-fluoropyridine-4-boronic acid AldrichCPR C5H5BFNO2
CDS007991 3-fluoropyridine-4-boronic acid AldrichCPR C5H5BFNO2
CDS011866 5-fluoropyridine-3-boronic acid AldrichCPR C5H5BFNO2
CDS014596 2-chloro-3-fluoropyridine-4-boronic acid hydrate AldrichCPR C5H6BClFNO3
CDS006389 3-fluoropyridine-4-boronic acid hydrate AldrichCPR C5H7BFNO3
SYX00006 4-Bromo-2-fluorophenylboronic acid AldrichCPR C6H5BBrFO2
CDS001433 2-Fluoroquinoline-3-boronic acid AldrichCPR C9H7BFNO2
CDS008191 7-fluoro-2-methylquinolin-8-ylboronic acid AldrichCPR C10H9BFNO2
MIDA033 6-Trifluoromethyl-2-pyridyl-boronic acid MIDA ester AldrichCPR C11H10BF3N2O4
CDS017689 4-(benzyloxy)-2-fluorophenylboronic acid AldrichCPR C13H12BFO3
CDS008544 1-Boc-5-fluoroindole-2-boronic acid AldrichCPR C13H15BFNO4
CDS008246 N-(Boc)-6-fluoroindole-2-boronic acid AldrichCPR C13H15BFNO4
ADE001024 5-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine AldrichCPR C13H16BFN2O2
ADE000817 2-Fluoro-4-iodo-6-(pyrrolidin-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine AldrichCPR C15H21BFIN2O2
ADE000785 2-Fluoro-6-(pyrrolidin-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine AldrichCPR C15H22BFN2O2
ADE000111 2-Fluoro-6-(pyrrolidin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine AldrichCPR C15H22BFN2O2
CDS010489 3-fluoro-2-(4-morpholino)pyridine-4-boronic acid pinacol ester AldrichCPR C15H22BFN2O3
ADE000120 N-(5-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)pivalamide AldrichCPR C16H24BFN2O3
ADE001111 5-fluoro-6-iodo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine AldrichCPR C22H35BFIN2O2Si
ADE001054 5-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine AldrichCPR C22H36BFN2O2Si
ADE001101 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine AldrichCPR C23H36BF3N2O2Si