Heteroaryl Boronic Acids

Product #



Molecular Formula

Add to Cart

CDS007044 isoxazole-4-boronic acid AldrichCPR C3H4BNO3
720429 1H-Pyrazol-3-ylboronic acid hydrate C3H5BN2O2 · xH2O
706256 1H-Pyrazole-4-boronic acid ≥95.0% C3H5BN2O2
CDS014043 1H-Pyrazole-5-boronic acid AldrichCPR C3H5BN2O2
CDS015511 Imidazole-2-boronic acid AldrichCPR C3H5BN2O2
CDS009360 3,4-dibromothiophene-2-boronic acid AldrichCPR C4H3BBr2O2S
CDS006519 3-bromothiophene-4-boronic acid AldrichCPR C4H4BBrO2S
CDS014716 3-bromothiophene-5-boronic acid AldrichCPR C4H4BBrO2S
557684 5-Bromo-2-thienylboronic acid ≥95% C4H4BBrO2S
CDS007059 2-chlorothiophene-3-boronic acid AldrichCPR C4H4BClO2S
CDS004266 3-chlorothiophene-2-boronic acid AldrichCPR C4H4BClO2S
499935 5-Chloro-2-thienylboronic acid C4H4BClO2S
CDS013999 pyrimidine-5-boronic acid AldrichCPR C4H5BN2O2
CDS001345 Uracil-5-boronic acid AldrichCPR C4H5BN2O4
436836 2-Thienylboronic acid ≥95.0% C4H5BO2S
436844 3-Thienylboronic acid ≥95.0% C4H5BO2S
464910 2-Furanylboronic acid ≥95.0% C4H5BO3
512168 3-Furanylboronic acid ≥95.0% C4H5BO3
706221 2-Aminopyrimidine-5-boronic acid ≥95.0% C4H6BN3O2
470317 2,5-Thiophenediylbisboronic acid ≥95.0% C4H6B2O4S
CDS006695 1-Methyl-1H-pyrazol-5-ylboronic acid AldrichCPR C4H7BN2O2
CDS015599 1-methyl-1H-pyrazole-4-boronic acid AldrichCPR C4H7BN2O2
CDS007127 3-methylpyrazole-4-boronic acid AldrichCPR C4H7BN2O2
CDS001319 5-Bromo-2-fluoropyridine-3-boronic acid AldrichCPR C5H4BBrFNO2
CDS015600 3,5-dibromopyridine-4-boronic acid AldrichCPR C5H4BBr2NO2
CDS009014 6-chloro-2-fluoropyridine-3-boronic acid AldrichCPR C5H4BClFNO2
CDS006785 2,3-dichloropyridine-4-boronic acid AldrichCPR C5H4BCl2NO2
CDS007852 2,6-dichloropyridine-3-boronic acid AldrichCPR C5H4BCl2NO2
CDS010298 2,6-difluoropyridine-4-boronic acid AldrichCPR C5H4BF2NO2
CDS006020 2-bromopyridine-3-boronic acid AldrichCPR C5H5BBrNO2
686816 5-Bromopyridine-3-boronic acid ≥95% C5H5BBrNO2
666556 6-Bromo-3-pyridinylboronic acid ≥95% C5H5BBrNO2
666513 2-Chloro-4-pyridinylboronic acid ≥95.0% C5H5BClNO2
697095 2-Chloropyridine-3-boronic acid C5H5BClNO2
CDS007847 3-chloro-4-pyridineboronic acid AldrichCPR C5H5BClNO2
721034 5-Chloro-3-pyridineboronic acid ≥95% C5H5BClNO2
CDS002921 5-Chloropyridine-2-boronic acid AldrichCPR C5H5BClNO2
637386 6-Chloro-3-pyridinylboronic acid ≥95.0% C5H5BClNO2
696579 2-Fluoro-3-pyridineboronic acid ≥95% C5H5BFNO2
CDS003936 2-fluoropyridine-4-boronic acid AldrichCPR C5H5BFNO2
CDS007991 3-fluoropyridine-4-boronic acid AldrichCPR C5H5BFNO2
CDS011866 5-fluoropyridine-3-boronic acid AldrichCPR C5H5BFNO2
639184 6-Fluoro-3-pyridinylboronic acid C5H5BFNO2
499900 2-Formyl-3-thiopheneboronic acid ≥95% C5H5BO3S
499919 3-Formyl-2-thienylboronic acid ≥95% C5H5BO3S
514055 5-Formyl-2-thienylboronic acid ≥95.0% C5H5BO3S
CDS004568 5-formylthiophene-3-boronic acid AldrichCPR C5H5BO3S
512346 5-Formyl-2-furanylboronic acid ≥95% C5H5BO4
CDS005028 3-borono-2-thiophenecarboxylic acid AldrichCPR C5H5BO4S
CDS004504 5-(Dihydroxyboryl)-2-thiophenecarboxylic acid AldrichCPR C5H5BO4S
CDS014596 2-chloro-3-fluoropyridine-4-boronic acid hydrate AldrichCPR C5H6BClFNO3
CDS020044 2,6-Difluoropyridine-3-boronic acid hydrate AldrichCPR C5H6BF2NO3
731730 1-Methyl-3-trifluoromethyl-1H-pyrazole-5-boronic acid ≥95% C5H6BF3N2O2
CDS009263 2-Pyridineboronic acid AldrichCPR C5H6BNO2
512125 3-Pyridinylboronic acid ≥95.0% C5H6BNO2
634492 4-Pyridinylboronic acid 90% C5H6BNO2
CDS007117 (6-hydroxypyridin-3-yl)boronic acid AldrichCPR C5H6BNO3
CDS006321 pyridine-4-boronic acid hydrochloride AldrichCPR C5H7BClNO2
CDS004304 3-chloro-4-pyridineboronic acid hydrate AldrichCPR C5H7BClNO3
CDS006389 3-fluoropyridine-4-boronic acid hydrate AldrichCPR C5H7BFNO3
CDS004436 3-methylthiophene-2-boronic acid AldrichCPR C5H7BO2S
542393 4-Methyl-3-thienylboronic acid ≥95% C5H7BO2S
CDS003645 4-methylthiophene-2-boronic acid AldrichCPR C5H7BO2S
512192 5-Methyl-2-thienylboronic acid C5H7BO2S
CDS019945 5-Methyl-2-furanboronic acid AldrichCPR C5H7BO3
720410 3,5-Dimethylisoxazol-4-yl-4-boronic acid ≥95% C5H8BNO3
CDS007058 1,3-dimethylpyrazole-5-boronic acid AldrichCPR C5H9BN2O2
CDS007030 1-ethylpyrazole-4-boronic acid AldrichCPR C5H9BN2O2
CDS010102 2-(trifluoromethyl)pyridine-4-boronic acid AldrichCPR C6H5BF3NO2
CDS020572 4-(Trifluoromethyl)pyridine-3-boronic acid AldrichCPR C6H5BF3NO2
CDS017238 3-cyanopyridine-4-boronic acid AldrichCPR C6H5BN2O2
CDS009086 5-cyano-3-pyridinyl boronic acid AldrichCPR C6H5BN2O2
CDS007307 5-cyano-4-methylthiophene-2-boronic acid AldrichCPR C6H6BNO2S
CDS009971 3-chloro-2-methoxypyridine-4-boronic acid AldrichCPR C6H7BClNO3
CDS019715 3-Chloro-2-methoxypyridine-5-boronic acid AldrichCPR C6H7BClNO3
CDS019957 3-Fluoro-2-methoxypyridine-5-boronic acid AldrichCPR C6H7BFNO3
CDS015768 4-(trifluoromethyl)pyridine-3-boronic acid hydrate AldrichCPR C6H7BF3NO3
701939 2-Acetyl-3-thiopheneboronic acid C6H7BO3S
499927 5-Acetyl-2-thienylboronic acid C6H7BO3S
CDS005463 5-(methoxycarbonyl)thiophene-3-boronic acid AldrichCPR C6H7BO4S
CDS007306 Thiophene-2-carboxylic acid methyl ester-5-boric acid AldrichCPR C6H7BO4S
CDS019614 2-Methylpyridine-3-boronic acid AldrichCPR C6H8BNO2
CDS004296 2-picoline-4-boronic acid AldrichCPR C6H8BNO2
CDS009593 3-methylpyridine-2-boronic acid AldrichCPR C6H8BNO2
CDS007506 4-methylpyridine-2-boronic acid AldrichCPR C6H8BNO2
CDS003860 4-methylpyridine-3-boronic acid AldrichCPR C6H8BNO2
CDS007487 5-methylpyridine-2-boronic acid AldrichCPR C6H8BNO2
CDS020146 5-Methylpyridine-3-boronic acid AldrichCPR C6H8BNO2
CDS020001 6-Methylpyridine-3-boronic acid AldrichCPR C6H8BNO2
SYX00028 2-Methylthiopyridine-5-boronic acid AldrichCPR C6H8BNO2S
684589 2-Methoxy-3-pyridinylboronic acid ≥95.0% C6H8BNO3
CDS007799 2-methoxypyridine-4-boronic acid AldrichCPR C6H8BNO3
CDS004292 5-methoxypyridine-3-boronic acid AldrichCPR C6H8BNO3
CDS010165 6-(hydroxymethyl)pyridine-3-boronic acid AldrichCPR C6H8BNO3
637610 6-Methoxy-3-pyridinylboronic acid ≥95.0% C6H8BNO3
CDS013670 2-Picoline-4-boronic acid hydrochloride AldrichCPR C6H9BClNO2
CDS005381 2-ethoxypyrimidine-5-boronic acid AldrichCPR C6H9BN2O3
666491 2,4-Dimethoxy-5-pyrimidinylboronic acid 90% C6H9BN2O4
CDS008763 5-ethylthiophene-2-boronic acid AldrichCPR C6H9BO2S
CDS006985 3-methoxypyridine-4-boronic acid hydrate AldrichCPR C6H10BNO4
CDS005265 2-dimethylaminopyrimidinyl-5-boronic acid AldrichCPR C6H10BN3O2
CDS008131 1,3,5-Trimethyl-1H-pyrazol-4-ylboronic acid AldrichCPR C6H11BN2O2
CDS019261 1,3-Benzothiazol-6-ylboronic acid AldrichCPR C7H6BNO2S
CDS009087 [6-(2,2,2-trifluoroethoxy)pyridin-3-yl]boronic acid AldrichCPR C7H7BF3NO3
724017 1H-Indazole-5-boronic acid ≥95% C7H7BN2O2
CDS009958 Imidazo[1,2-a]pyridine-6-boronic acid AldrichCPR C7H7BN2O2
720828 Indazole-6-boronic acid C7H7BN2O2
715409 1H-Indazole-5-boronic acid hydrochloride C7H8BClN2O2
709379 Indazole-4-boronic acid hydrochloride C7H8BClN2O2
CDS005468 2-(methylcarboxy)pyridine-5-boronic acid AldrichCPR C7H8BNO4
CDS006725 5-bromo-2-ethoxy-4-pyridineboronic acid AldrichCPR C7H9BBrNO3
CDS020467 5-Chloro-6-ethoxypyridine-3-boronic acid AldrichCPR C7H9BClNO3
CDS019114 2-Cyclopropylpyrimidin-5-ylboronic acid AldrichCPR C7H9BN2O2
CDS006669 2-acetamidopyridine-5-boronic acid AldrichCPR C7H9BN2O3
CDS010143 2,5-dimethylpyridine-3-boronic acid AldrichCPR C7H10BNO2
CDS007545 2,6-dimethyl-pyridine-3-boronic acid AldrichCPR C7H10BNO2
CDS009973 2-methoxy-4-methylpyridine-5-boronic acid AldrichCPR C7H10BNO3
CDS019618 2-Methyl-6-methoxypyridine-3-boronic acid AldrichCPR C7H10BNO3
718815 6-Ethoxy-3-pyridinylboronic acid C7H10BNO3
CDS019714 6-Methoxy-5-methylpyridine-3-boronic acid AldrichCPR C7H10BNO3
706086 2,6-Dimethoxy-3-pyridineboronic acid ≥95% C7H10BNO4
CDS019842 4-Isopropylpyrimidine-5-boronic acid AldrichCPR C7H11BN2O2
CDS006044 2-(dimethylamino)pyridine-5-boronic acid hydrate AldrichCPR C7H13BN2O3
CDS006698 5-bromobenzo[b]thiophene-2-boronic acid AldrichCPR C8H6BBrO2S
499978 Benzo[b]thien-2-ylboronic acid ≥95% C8H7BO2S
512117 Benzo[b]thien-3-ylboronic acid ≥95.0% C8H7BO2S
CDS006323 2,2′-bithiophene-5-boronic acid AldrichCPR C8H7BO2S2
499943 2-Benzofuranylboronic acid ≥95% C8H7BO3
CDS013896 Benzopyrazine-6-boronic acid hydrochloride AldrichCPR C8H8BClN2O2
666467 5-Indolylboronic acid ≥95% C8H8BNO2
666459 6-Indolylboronic acid ≥95% C8H8BNO2
CDS013942 indole-4-boronic acid AldrichCPR C8H8BNO2
CDS020541 2-Methylbenzothiazole-5-boronic acid AldrichCPR C8H8BNO2S
CDS019574 (1-Methyl-1H-benzimidazol-5-yl)boronic acid AldrichCPR C8H9BN2O2
CDS010063 1-Methyl-1H-benzoimidazole-6-boronic acid AldrichCPR C8H9BN2O2
720798 1-Methyl-1H-indazole-6-boronic acid ≥95% C8H9BN2O2
CDS007164 1-methylindazole-5-boronic acid AldrichCPR C8H9BN2O2
720836 2-Methyl-2H-indazole-6-boronic acid C8H9BN2O2
CDS019412 3-Methyl-1H-indazole-6-boronic acid AldrichCPR C8H9BN2O2
CDS019128 7-Methylimidazo[1,2-a]pyridine-6-boronic acid AldrichCPR C8H9BN2O2
CDS013618 2,3-dihydrobenzofuran-5-boronic acid AldrichCPR C8H9BO3
635995 1,4-Benzodioxane-6-boronic acid ≥95% C8H9BO4
CDS019151 3-(Carboxymethyl)benzeneboronic acid AldrichCPR C8H9BO4
723606 1-Methyl-1H-indazole-4-boronic acid hydrochloride C8H10BClN2O2
CDS003695 2-chloro-6-isopropylpyridine-3-boronic acid AldrichCPR C8H11BClNO2
CDS020489 5-Chloro-6-isopropoxypyridine-3-boronic acid AldrichCPR C8H11BClNO3
CDS005072 2-isoproxypyridine-5-boronic acid AldrichCPR C8H12BNO3
CDS019698 6-Ethoxy-5-methylpyridine-3-boronic acid AldrichCPR C8H12BNO3
CDS020128 (2-Pyrrolidin-1-ylpyrimidin-5-yl)boronic acid AldrichCPR C8H12BN3O2
CDS020475 2-Morpholinopyrimidin-5-ylboronic acid AldrichCPR C8H12BN3O3
CDS010360 1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-ylboronic acid AldrichCPR C8H13BN2O3
CDS009357 1-(3-Methylbutyl)-1H-pyrazole-4-boronic acid AldrichCPR C8H15BN2O2
696684 2-Chloro-3-quinolineboronic acid ≥95% C9H7BClNO2
CDS001433 2-Fluoroquinoline-3-boronic acid AldrichCPR C9H7BFNO2
CDS019577 8-Fluoroquinoline-6-boronic acid AldrichCPR C9H7BFNO2
CDS007234 5-Cyano-1H-indole-2-boronic acid AldrichCPR C9H7BN2O2
CDS008061 1-(3-Chlorophenyl)-1H-pyrazol-4-ylboronic acid AldrichCPR C9H8BClN2O2
709522 3-Quinolineboronic acid C9H8BNO2
691909 3-Quinolineboronic acid technical grade C9H8BNO2
707929 4-Isoquinolineboronic acid C9H8BNO2
686867 5-Isoquinolineboronic acid ≥95.0% C9H8BNO2
542865 8-Quinolinylboronic acid technical grade C9H8BNO2
CDS010117 isoquinoline-6-boronic acid AldrichCPR C9H8BNO2
CDS009275 isoquinoline-7-boronic acid AldrichCPR C9H8BNO2
CDS007867 quinoline-4-boronic acid AldrichCPR C9H8BNO2
CDS007279 quinoline-6-boronic acid AldrichCPR C9H8BNO2
CDS007971 3-pyrazol-1-yl-phenylboronic acid AldrichCPR C9H9BN2O2
CDS009959 4-pyrazol-1-yl-phenylboronic acid AldrichCPR C9H9BN2O2
CDS007724 2-(3-boronophenyl)-5-methyl-1,3,4-oxadiazole AldrichCPR C9H9BN2O3
716480 1H-Inden-3-ylboronic acid 95% C9H9BO2
CDS005944 N-Methylindole-5-boronic acid AldrichCPR C9H10BNO2
CDS018401 4-(5-oxopyrazolidin-3-yl)phenylboronic acid AldrichCPR C9H11BN2O3
CDS014011 3,4-Dihydro-2H-1,5-benzodioxepin-7-ylboronic acid AldrichCPR C9H11BO4
CDS019976 2-(Cyclopropylmethoxy)pyridine-5-boronic acid AldrichCPR C9H12BNO3
CDS020443 3-Chloro-2-isobutoxypyridine-5-boronic acid AldrichCPR C9H13BClNO3
704768 2-(Pyrrolidin-1-yl)pyridine-3-boronic acid C9H13BN2O2
CDS020160 6-(Pyrrolidin-1-yl)pyridine-3-boronic acid AldrichCPR C9H13BN2O2
705039 2-Morpholinopyridine-3-boronic acid C9H13BN2O3
CDS007070 6-morpholinopyridin-3-ylboronic acid AldrichCPR C9H13BN2O3
15047 N-Boc-2-pyrroleboronic acid ≥98.0% (T) C9H14BNO4
CDS020479 (2-Piperidin-1-ylpyrimidin-5-yl)boronic acid AldrichCPR C9H14BN3O2
CDS020497 2-(4-Methylpiperazin-1-yl)pyrimidin-5-ylboronic acid AldrichCPR C9H15BN4O2
CDS008191 7-fluoro-2-methylquinolin-8-ylboronic acid AldrichCPR C10H9BFNO2
CDS005082 4-(2-thiazolyl)aminocarbonylphenylboronic acid AldrichCPR C10H9BN2O3S
CDS005916 5-Phenyl-2-thienylboronic acid AldrichCPR C10H9BO2S
797049 (6-Methyl-5-quinolinyl)boronic acid 95% C10H10BNO2
CDS018525 5-methyl-3-phenyl-4-isoxazolylboronic acid AldrichCPR C10H10BNO3
720445 1-Benzyl-1H-pyrazole-4-boronic acid ≥95% C10H11BN2O2
CDS005293 N-(thiazoline-2-yl) 4-boronobenzamide AldrichCPR C10H11BN2O3S
715441 3-(Trifluoromethyl)-1H-pyrazole-4-boronic acid pinacol ester 97% C10H14BF3N2O2
CDS007134 3-(pyrrolidino)phenylboronic acid AldrichCPR C10H14BNO2
CDS018247 2-(morpholino)phenylboronic acid AldrichCPR C10H14BNO3
CDS017484 3-(morpholino)phenylboronic acid AldrichCPR C10H14BNO3
CDS005076 4-morpholinophenylboronic acid AldrichCPR C10H14BNO3
CDS005103 3-(pyrrolidin-1-ylsulfonyl)phenylboronic acid AldrichCPR C10H14BNO4S
CDS007679 4-(4-morpholinylsulfonyl)phenylboronic acid AldrichCPR C10H14BNO5S
CDS018273 3-(Morpholin-1-yl)phenylboronic acid hydrochloride AldrichCPR C10H15BClNO3
CDS020471 6-(Piperidin-1-yl)pyridin-3-ylboronic acid AldrichCPR C10H15BN2O2
CDS006970 5-(tert-Butylcarbamoyl)pyridine-3-boronic acid AldrichCPR C10H15BN2O3
CBR01468 {6-[(2,2-Dimethylpropanoyl)amino]-3-pyridinyl}boronic acid AldrichCPR C10H15BN2O3
CDS007390 4-(2-(1H-Pyrazol-1-yl)ethoxy)phenylboronic acid AldrichCPR C11H13BN2O3
CDS004397 3-(pyrrolidine-1-carbonyl)phenylboronic acid AldrichCPR C11H14BNO3
CDS003611 4-(pyrrolidine-1-carbonyl)phenylboronic acid AldrichCPR C11H14BNO3
CDS005328 [3-(thiomorpholine-4-carbonyl)phenyl]boronic acid AldrichCPR C11H14BNO3S
CDS005937 4-(morpholine-4-carbonyl)phenylboronic acid AldrichCPR C11H14BNO4
CDS007959 n-morpholinyl 3-boronobenzamide AldrichCPR C11H14BNO4
CDS011838 3-(1-pyrrolidinylmethyl)phenylboronic acid AldrichCPR C11H16BNO2
CDS008846 3-(piperidin-1-yl)phenylboronic acid AldrichCPR C11H16BNO2
CDS012390 4-(1-pyrrolidinylmethyl)phenylboronic acid AldrichCPR C11H16BNO2
CDS014065 2-(4-morpholinylmethyl)phenylboronic acid AldrichCPR C11H16BNO3
CDS009415 3-(morpholinomethyl)phenylboronic acid AldrichCPR C11H16BNO3
CDS012386 [4-(morpholinomethyl)phenyl]boronic acid AldrichCPR C11H16BNO3
CDS010139 3-(piperidin-1-ylsulfonyl)phenylboronic acid AldrichCPR C11H16BNO4S
CDS014092 4-(1-Piperidinyl)phenylboronic acid hydrochloride AldrichCPR C11H17BClNO2
CBR00606 (8-Methoxy-2-methylquinolin-5-yl)boronic acid trihydrate AldrichCPR C11H18BNO6
499986 4-Dibenzothienylboronic acid ≥95.0% C12H9BO2S
CBR01389 Dibenzo[b,d]thien-2-ylboronic acid AldrichCPR C12H9BO2S
512214 1-Thianthrenylboronic acid ≥95% C12H9BO2S2
499951 4-(Dibenzofuranyl)boronic acid ≥95.0% C12H9BO3
CDS001606 2-(Benzyloxy)-3-pyridinylboronic acid AldrichCPR C12H12BNO3
CDS007760 2-benzyloxypyridine-5-boronic acid AldrichCPR C12H12BNO3
CDS017654 2-methoxy-5-(pyridine-4-yl)phenylboronic acid AldrichCPR C12H12BNO3
ADE001429 (1-(tert-Butoxycarbonyl)-5-chloro-1H-pyrrolo[3,2-b]pyridin-3-yl)boronic acid AldrichCPR C12H14BClN2O4
CDS008452 3-(4-oxopiperidine-1-carbonyl)phenylboronic acid AldrichCPR C12H14BNO4
CDS004586 3-(piperidine-1-carbonyl)phenylboronic acid AldrichCPR C12H16BNO3
CDS005409 4-(4-Methylpiperazine-1-carbonyl)phenylboronic acid hydrochloride AldrichCPR C12H18BClN2O3
CDS005378 3-(piperidin-1-ylmethyl)phenylboronic acid AldrichCPR C12H18BNO2
CDS012391 4-(1-piperidinylmethyl)phenylboronic acid AldrichCPR C12H18BNO2
CDS008939 2,4-ditert-butoxypyrimidin-5-ylboronic acid AldrichCPR C12H21BN2O4
CDS008619 2,4-di(tert-Butoxy)pyrimidin-5-ylboronic acid hydrate AldrichCPR C12H23BN2O5
CDS008221 1-Boc-5,6-dichloro-1H-indole-2-boronic acid AldrichCPR C13H14BCl2NO4
637394 (N-Boc-5-bromo-2-indolyl)boronic acid C13H15BBrNO4
741795 (N-Boc-5-chloro-2-indolyl)boronic acid 95% C13H15BClNO4
CDS005070 1-(tert-Butoxycarbonyl)-6-chloro-1H-indol-2-ylboronic acid AldrichCPR C13H15BClNO4
CDS005899 4-chloro-N-(Boc)-indole-2-boronic acid AldrichCPR C13H15BClNO4
CDS008544 1-Boc-5-fluoroindole-2-boronic acid AldrichCPR C13H15BFNO4
CDS008246 N-(Boc)-6-fluoroindole-2-boronic acid AldrichCPR C13H15BFNO4
675911 N-Boc-indole-2-boronic acid ≥95% C13H16BNO4
CDS004254 3-(4-methylpiperidine-1-carbonyl)phenylboronic acid AldrichCPR C13H18BNO3
CDS015480 4-(2-morpholinoethylcarbamoyl)phenylboronic acid AldrichCPR C13H19BN2O4
CDS005377 4-[(2-pyrrolidin-1-ylethyl)carbamoyl]benzeneboronic acid hydrochloride AldrichCPR C13H20BClN2O3
CDS003849 1-(triisopropylsilyl)pyrrole-3-boronic acid AldrichCPR C13H26BNO2Si
563862 1-(Phenylsulfonyl)-2-indolylboronic acid C14H12BNO4S
563870 1-(Phenylsulfonyl)-3-indolylboronic acid 97% C14H12BNO4S
CDS008004 1-Boc-5-cyano-1H-indole-2-boronic acid AldrichCPR C14H15BN2O4
CDS005752 1-Boc-6-cyano-2-indoleboronic acid AldrichCPR C14H15BN2O4
CDS005099 1-Boc-6-methylindole-2-boronic acid AldrichCPR C14H18BNO4
CDS007643 1-Boc-6-methoxyindole-2-boronic acid AldrichCPR C14H18BNO5
680516 N-Boc-5-methoxy-2-indolylboronic acid ≥95% C14H18BNO5
CDS005504 1-(tert-Butyldimethylsilyl)-1H-indol-6-ylboronic acid AldrichCPR C14H22BNO2Si
CDS006675 1-(t-Butoxycarbonyl)-6-(methoxycarbonyl)-1H-indol-2-ylboronic acid AldrichCPR C15H18BNO6
CDS019149 2-(4-Methylpiperazin-1-yl)pyridine-5-boronic acid pinacol ester AldrichCPR C16H26BN3O2
CDS005906 2,4-bis(benzyloxy)pyrimidine-5-boronic acid AldrichCPR C18H17BN2O4
CDS007945 4-Benzyloxy-1-tert-butoxycarbonylindole-2-boronic acid AldrichCPR C20H22BNO5
CDS005096 5-benzyloxy-1-Boc-indole-2-boronic acid AldrichCPR C20H22BNO5