Other Monoenoic fatty acids

Product #


Molecular Formula

Add to Cart

D221902 (2-Dodecen-1-yl)succinic anhydride 95% C16H26O3 266.4
N7644 (2-Nonen-1-yl)succinic anhydride ≥85% (titration) C13H20O3 224.3
74378 (2-Nonen-1-yl)succinic anhydride suitable for electron microscopy C13H20O3 224.3
124672 10-Undecenoic acid 98% CH2=CH(CH2)8COOH 184.3
O8382 17-Octadecynoic acid ≥95% (GC) C18H32O2 280.5
E4637 Elaidic acid ≥99.0% (GC) CH3(CH2)7CH=CH(CH2)7COOH 282.5
45089 Elaidic acid analytical standard CH3(CH2)7CH=CH(CH2)7COOH 282.5
E3385 Erucic acid ≥99% (capillary GC) CH3(CH2)7CH=CH(CH2)11COOH 338.6
45629 Erucic acid analytical standard CH3(CH2)7CH=CH(CH2)11COOH 338.6
45630 Erucic acid technical, ~90% (GC) CH3(CH2)7CH=CH(CH2)11COOH 338.6
M3525 Myristoleic acid ≥99% (capillary GC) CH3(CH2)3CH=CH(CH2)7CO2H 226.4
N1514 Nervonic acid ≥99% (capillary GC) CH3(CH2)7CH=CH(CH2)13COOH (cis) 366.6
87117 Nervonic acid analytical standard CH3(CH2)7CH=CH(CH2)13COOH (cis) 366.6
O1008 Oleic acid ≥99% (GC) CH3(CH2)7CH=CH(CH2)7COOH 282.5
364525 Oleic acid technical grade, 90% CH3(CH2)7CH=CH(CH2)7COOH 282.5
367850 Oleoyl chloride ≥89% CH3(CH2)7CH=CH(CH2)7COCl 300.9
P9417 Palmitoleic acid ≥98.5% (GC), liquid CH3(CH2)5CH=CH(CH2)7COOH 254.4
76169 Palmitoleic acid analytical standard CH3(CH2)5CH=CH(CH2)7COOH 254.4
P1635 Petroselinic acid sodium salt ~98% C18H33O2Na 304.4
O3880 Sodium oleate ≥95% (capillary GC) CH3(CH2)7CH=CH(CH2)7COONa 304.4
O7501 Sodium oleate ≥99% CH3(CH2)7CH=CH(CH2)7COONa 304.4
CDS003850 Sodium undecylenate AldrichCPR C11H19NaO2 206.3
329584 Zinc undecylenate 98% [H2C=CH(CH2)8CO2]2Zn 431.9
H8896 cis-10-Heptadecenoic acid ≥99% C17H32O2 268.4
N6394 cis-10-Nonadecenoic acid ≥99%, liquid C19H36O2 296.5
E3635 cis-11-Eicosenoic acid ≥99% (capillary GC) CH3(CH2)7CH=CH(CH2)9CO2H 310.5
44878 cis-11-Eicosenoic acid analytical standard CH3(CH2)7CH=CH(CH2)9CO2H 310.5
V0384 cis-Vaccenic acid ≥97% (capillary GC), oil CH3(CH2)5CH=CH(CH2)9CO2H 282.5
10823 trans-11-Eicosenoic acid analytical standard C20H38O2 310.5
V1131 trans-Vaccenic acid ≥99% (capillary GC) C18H34O2 282.5