Saltar al contenido
Merck
  • Synthesis and Characterization of a Series of Edge-Sharing Octahedral-Tetrahedral-Octahedral Linear Trinuclear Complexes [M(3)(L1O)(4)](2+), Where M = Mn(2+), Co(2+), Ni(2+), Cu(2+), and Zn(2+) and L1OH Is the "Heteroscorpionate" Ligand (2-Hydroxyphenyl)bis(pyrazolyl)methane.

Synthesis and Characterization of a Series of Edge-Sharing Octahedral-Tetrahedral-Octahedral Linear Trinuclear Complexes [M(3)(L1O)(4)](2+), Where M = Mn(2+), Co(2+), Ni(2+), Cu(2+), and Zn(2+) and L1OH Is the "Heteroscorpionate" Ligand (2-Hydroxyphenyl)bis(pyrazolyl)methane.

Inorganic chemistry (2001-10-24)
Timothy C. Higgs, K. Spartalian, Charles J. O'Connor, Berthold F. Matzanke, Carl J. Carrano
RESUMEN

The mixed functionality pyrazole/phenol ligand (2-hydroxyphenyl)bis(pyrazolyl)methane, L1OH, has been used to prepare a series of linear trimetallic systems with the general structural motif [M(3)(L1O)(4)](2+), where M = Mn(2+), Co(2+), Ni(2+), Cu(2+), and Zn(2+). Each of these complexes has been structurally characterized by X-ray crystallography giving the following structural parameters: [Zn(3)(L1O)(4)][BF(4)](2).H(2)O, C(52)H(44)N(16)B(2)F(8)O(5)Zn(3), monoclinic, a = 18.572(4) Å, b = 22.400(5) Å, c = 15.921(3), beta = 112.439(8) degrees, space group C2/c, Z = 4; [Cu(3)(L1O)(4)] [BF(4)](2).2MeCN, C(56)H(44)N(18)B(2)Cu(3)F(8)O(4), monoclinic, a = 40.574(2) Å, b = 16.701(1) Å, c = 19.841(2) Å, beta = 111.388(5) degrees, space group C2/c, Z = 8; [Ni(3)(L1O)(4)][ClO(4)](2).MeCN.0.5H(2)O, C(54)H(44)N(17)Cl(2)Ni(3)O(12.5), monoclinic, a = 12.324(4) Å, b = 26.537(2) Å, c = 18.829(3) Å, beta = 102.78(1) degrees, space group C2/c, Z = 4; [Co(3)(L1O)(4)][BF(4)](2).MeCN, C(54)H(44)N(17)B(2)Co(3)F(8)O(4), monoclinic, a = 12.395(2) Å, b = 26.483(3) Å, c = 18.703(4) Å, beta = 103.22(2) degrees, space group C2/c, Z = 4; [Mn(3)(L1O)(4)(MeCN)][ClO(4)](2).1.4MeCN, C(56.68)H(44)N(18.34)Cl(2)Mn(3)O(12), orthorhombic, a = 15.471(2) Å, b = 17.364(2) Å, c = 24.216(2) Å, space group Pbcn, Z = 4. For Zn(2+), Cu(2+), Ni(2+), and Co(2+) the central metal atom of the linear trimetallic [M(3)(L1O)(4)](2+) unit is four coordinate and has a pseudotetrahedral geometry with a dihedral angle, omega, between the two M(central)O(2)M(terminal) planes of 79.9 degrees (Zn), 61.2 degrees (Co), 60.4 degrees (Ni), and 46.8 degrees (Cu). The central Mn(2+) atom of [Mn(3)(L1O)(4)(MeCN)][ClO(4)](2).1.4MeCN is five-coordinate, with a trigonal bipyramidal stereochemistry, the result of an equatorially coordinated MeCN solvent molecule. Variable-temperature magnetic data indicate that the Ni, Cu, and Mn complexes display modest antiferromagnetic coupling between the metal centers, while the Co derivative is strongly ferromagnetically coupled.

MATERIALES
Número de producto
Marca
Descripción del producto

Sigma-Aldrich
Nickel(II) perchlorate hexahydrate
Sigma-Aldrich
Copper(II) tetrafluoroborate hydrate
Sigma-Aldrich
Manganese(II) perchlorate hydrate, 99%