401595
4-(Diphenylphosphino)benzoic acid
97%
Synonym(s):
(4-Carboxyphenyl)diphenylphosphine, Diphenyl(p-carboxyphenyl) phosphine, p-(Diphenylphosphino)benzoic acid
Select a Size
| Size/SKU | Availability | Price |
|---|---|---|
1 g | Check Cart for Availability | $110.00 |
5 g | Check Cart for Availability | $235.00 |
About This Item
$110.00
Quality Segment
assay
97%
reaction suitability
reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Heck Reaction, reaction type: Hiyama Coupling, reaction type: Negishi Coupling, reaction type: Sonogashira Coupling, reaction type: Stille Coupling, reaction type: Suzuki-Miyaura Coupling, reagent type: ligand
mp
157-160 °C (lit.)
functional group
phosphine
SMILES string
OC(=O)c1ccc(cc1)P(c2ccccc2)c3ccccc3
InChI
1S/C19H15O2P/c20-19(21)15-11-13-18(14-12-15)22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H,(H,20,21)
InChI key
GXMHDTPYKRTARV-UHFFFAOYSA-N
General description
Application
- Organostannoxane-supported palladium nanoparticles. The resulting catalysts show high activity and selectivity in Suzuki-coupling reactions.
- Polymetallic ruthenium-zinc complex catalyst for the hydrogenation of levulinic acid to γ-valerolactone.
1 of 1
This Item | |||
|---|---|---|---|
| description 97% | description 97% | description 98% | description 97% |
| reaction suitability reaction type: Hiyama Coupling, reaction type: Suzuki-Miyaura Coupling, reaction type: Heck Reaction, reaction type: Sonogashira Coupling, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Stille Coupling, reagent type: ligand, reaction type: Negishi Coupling | reaction suitability reaction type: Stille Coupling, reaction type: Negishi Coupling, reaction type: Hiyama Coupling, reaction type: Sonogashira Coupling, reaction type: Suzuki-Miyaura Coupling, reaction type: Heck Reaction, reaction type: Buchwald-Hartwig Cross Coupling Reaction | reaction suitability reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Heck Reaction, reaction type: Sonogashira Coupling, reaction type: Suzuki-Miyaura Coupling, reagent type: ligand, reaction type: Negishi Coupling, reaction type: Stille Coupling, reaction type: Hiyama Coupling | reaction suitability reaction type: Hiyama Coupling, reaction type: Negishi Coupling, reaction type: Sonogashira Coupling, reaction type: Suzuki-Miyaura Coupling, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reagent type: ligand, reaction type: Heck Reaction, reaction type: Stille Coupling |
| functional group phosphine | functional group phosphine | functional group phosphine | functional group aldehyde, phosphine |
| Quality Level 100 | Quality Level 100 | Quality Level 100 | Quality Level 100 |
| mp 157-160 °C (lit.) | mp 174-181 °C (lit.) | mp 105-110 °C (lit.) | mp 112-115 °C (lit.) |
| assay 97% | assay 97% | assay 98% | assay 97% |
Signal Word
Warning
Hazard Codes
Precautionary Statements
Hazard Classifications
Eye Irrit. 2 - Skin Irrit. 2 - STOT SE 3
Target Organs
Respiratory system
Storage Class
11 - Combustible Solids
WGK
WGK 3
PPE (personal protective equipment)
dust mask type N95 (US), Eyeshields, Gloves
Choose from one of the most recent versions:
Already Own This Product?
Find documentation for the products that you have recently purchased in the Document Library.